C9H12F5N3O2 — CID 104634696
1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]-2-propan-2-yloxyethanamine (PubChem CID 104634696) has the molecular formula C9H12F5N3O2 and a molecular weight of 289.20 g/mol. Its IUPAC name is 1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]-2-propan-2-yloxyethanamine.
| Compound Name | 1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 104634696 |
| Molecular Formula | C9H12F5N3O2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]-2-propan-2-yloxyethanamine |
| SMILES | CC(C)OCC(N)c1noc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F5N3O2/c1-4(2)18-3-5(15)6-16-7(19-17-6)8(10,11)9(12,13)14/h4-5H,3,15H2,1-2H3 |
| InChIKey | NFQGITKMSDXWPJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|