C9H15F3N4O2 — CID 103211824
N',N'-dimethyl-1-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine (PubChem CID 103211824) has the molecular formula C9H15F3N4O2 and a molecular weight of 268.24 g/mol. Its IUPAC name is N',N'-dimethyl-1-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-1-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 103211824 |
| Molecular Formula | C9H15F3N4O2 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N',N'-dimethyl-1-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine |
| SMILES | CN(C)CC(N)c1noc(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H15F3N4O2/c1-16(2)3-6(13)8-14-7(18-15-8)4-17-5-9(10,11)12/h6H,3-5,13H2,1-2H3 |
| InChIKey | NJHKRJVLNNAZLW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |