C14H28N4O — CID 104635083
N',N'-dimethyl-1-[5-(2,4,4-trimethylpentyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine (PubChem CID 104635083) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is N',N'-dimethyl-1-[5-(2,4,4-trimethylpentyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-1-[5-(2,4,4-trimethylpentyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 104635083 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N',N'-dimethyl-1-[5-(2,4,4-trimethylpentyl)-1,2,4-oxadiazol-3-yl]ethane-1,2-diamine |
| SMILES | CC(Cc1nc(C(N)CN(C)C)no1)CC(C)(C)C |
| InChI | InChI=1S/C14H28N4O/c1-10(8-14(2,3)4)7-12-16-13(17-19-12)11(15)9-18(5)6/h10-11H,7-9,15H2,1-6H3 |
| InChIKey | PMVILVKRXVDGIZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |