C9H11F2N3O2 — CID 106527740
3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanenitrile (PubChem CID 106527740) has the molecular formula C9H11F2N3O2 and a molecular weight of 231.20 g/mol. Its IUPAC name is 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanenitrile.
| Compound Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanenitrile |
|---|---|
| PubChem CID | 106527740 |
| Molecular Formula | C9H11F2N3O2 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanenitrile |
| SMILES | N#CCCc1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C9H11F2N3O2/c10-7(11)6-15-5-3-8-13-9(16-14-8)2-1-4-12/h7H,1-3,5-6H2 |
| InChIKey | LTHIAZGQIWOWDF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|