C8H11N3O — CID 106523822
4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanenitrile (PubChem CID 106523822) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanenitrile.
| Compound Name | 4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanenitrile |
|---|---|
| PubChem CID | 106523822 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanenitrile |
| SMILES | CCc1noc(CCCC#N)n1 |
| InChI | InChI=1S/C8H11N3O/c1-2-7-10-8(12-11-7)5-3-4-6-9/h2-5H2,1H3 |
| InChIKey | YRWKLYKNZQNAQJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|