C10H14Cl2N4O2 — CID 161311247
5-(chloromethyl)-3-ethyl-1,2,4-oxadiazole (PubChem CID 161311247) has the molecular formula C10H14Cl2N4O2 and a molecular weight of 293.15 g/mol. Its IUPAC name is 5-(chloromethyl)-3-ethyl-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 161311247 |
| Molecular Formula | C10H14Cl2N4O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-(chloromethyl)-3-ethyl-1,2,4-oxadiazole |
| SMILES | CCc1noc(CCl)n1.CCc1noc(CCl)n1 |
| InChI | InChI=1S/2C5H7ClN2O/c2*1-2-4-7-5(3-6)9-8-4/h2*2-3H2,1H3 |
| InChIKey | VIXLPBMOPCRQCK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|