C5H8N2OS — CID 130569000
(5-ethyl-1,2,4-oxadiazol-3-yl)methanethiol (PubChem CID 130569000) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is (5-ethyl-1,2,4-oxadiazol-3-yl)methanethiol.
| Compound Name | (5-ethyl-1,2,4-oxadiazol-3-yl)methanethiol |
|---|---|
| PubChem CID | 130569000 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (5-ethyl-1,2,4-oxadiazol-3-yl)methanethiol |
| SMILES | CCc1nc(CS)no1 |
| InChI | InChI=1S/C5H8N2OS/c1-2-5-6-4(3-9)7-8-5/h9H,2-3H2,1H3 |
| InChIKey | YWWJVBWRRGQGGR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|