C5H7IN2O — CID 64787979
5-ethyl-3-(iodomethyl)-1,2,4-oxadiazole (PubChem CID 64787979) has the molecular formula C5H7IN2O and a molecular weight of 238.03 g/mol. Its IUPAC name is 5-ethyl-3-(iodomethyl)-1,2,4-oxadiazole.
| Compound Name | 5-ethyl-3-(iodomethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 64787979 |
| Molecular Formula | C5H7IN2O |
| Molecular Weight | 238.03 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 5-ethyl-3-(iodomethyl)-1,2,4-oxadiazole |
| SMILES | CCc1nc(CI)no1 |
| InChI | InChI=1S/C5H7IN2O/c1-2-5-7-4(3-6)8-9-5/h2-3H2,1H3 |
| InChIKey | GARSAVBLXTZZCZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.03 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|