C8H11N3O3S — CID 106524629
4-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]butanenitrile (PubChem CID 106524629) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]butanenitrile.
| Compound Name | 4-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]butanenitrile |
|---|---|
| PubChem CID | 106524629 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]butanenitrile |
| SMILES | CS(=O)(=O)Cc1noc(CCCC#N)n1 |
| InChI | InChI=1S/C8H11N3O3S/c1-15(12,13)6-7-10-8(14-11-7)4-2-3-5-9/h2-4,6H2,1H3 |
| InChIKey | CCTYWISKEYWJPF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 96.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|