C9H14N4O — CID 106527426
4-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]butanenitrile (PubChem CID 106527426) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]butanenitrile.
| Compound Name | 4-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]butanenitrile |
|---|---|
| PubChem CID | 106527426 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 4-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]butanenitrile |
| SMILES | CCN(C)c1noc(CCCC#N)n1 |
| InChI | InChI=1S/C9H14N4O/c1-3-13(2)9-11-8(14-12-9)6-4-5-7-10/h3-6H2,1-2H3 |
| InChIKey | DITDPABMUOCHKP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|