C6H12N4O2 — CID 116808238
O-[[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine (PubChem CID 116808238) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is O-[[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine.
| Compound Name | O-[[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 116808238 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | O-[[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]methyl]hydroxylamine |
| SMILES | CCN(C)c1noc(CON)n1 |
| InChI | InChI=1S/C6H12N4O2/c1-3-10(2)6-8-5(4-11-7)12-9-6/h3-4,7H2,1-2H3 |
| InChIKey | DUGVLSZAKAWCKH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|