C6H9N3O2 — CID 79427579
O-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]hydroxylamine (PubChem CID 79427579) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is O-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]hydroxylamine.
| Compound Name | O-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 79427579 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | O-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]hydroxylamine |
| SMILES | NOCc1nc(C2CC2)no1 |
| InChI | InChI=1S/C6H9N3O2/c7-10-3-5-8-6(9-11-5)4-1-2-4/h4H,1-3,7H2 |
| InChIKey | UQPXGRQASZGXLX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|