C7H10N2OS — CID 170202003
2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanethiol (PubChem CID 170202003) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanethiol.
| Compound Name | 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanethiol |
|---|---|
| PubChem CID | 170202003 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanethiol |
| SMILES | SCCc1nc(C2CC2)no1 |
| InChI | InChI=1S/C7H10N2OS/c11-4-3-6-8-7(9-10-6)5-1-2-5/h5,11H,1-4H2 |
| InChIKey | CSJPSOFEEXGWQE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|