C9H15N3O — CID 63348149
4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butan-2-amine (PubChem CID 63348149) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butan-2-amine.
| Compound Name | 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 63348149 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butan-2-amine |
| SMILES | CC(N)CCc1nc(C2CC2)no1 |
| InChI | InChI=1S/C9H15N3O/c1-6(10)2-5-8-11-9(12-13-8)7-3-4-7/h6-7H,2-5,10H2,1H3 |
| InChIKey | KJODWEFBMJKJPH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |