C12H21N3O — CID 65391886
3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propan-1-amine (PubChem CID 65391886) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propan-1-amine.
| Compound Name | 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 65391886 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propan-1-amine |
| SMILES | NCCCc1nc(C2CCCCCC2)no1 |
| InChI | InChI=1S/C12H21N3O/c13-9-5-8-11-14-12(15-16-11)10-6-3-1-2-4-7-10/h10H,1-9,13H2 |
| InChIKey | IGSBCIZSKTYDOV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |