C13H20N2O3 — CID 65390511
4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)butanoic acid (PubChem CID 65390511) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)butanoic acid.
| Compound Name | 4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 65390511 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)butanoic acid |
| SMILES | O=C(O)CCCc1nc(C2CCCCCC2)no1 |
| InChI | InChI=1S/C13H20N2O3/c16-12(17)9-5-8-11-14-13(15-18-11)10-6-3-1-2-4-7-10/h10H,1-9H2,(H,16,17) |
| InChIKey | XAVCFIZNZFVDNB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |