3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid

C12H18N2O3 — CID 65390508

IUPAC3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid
SMILESO=C(O)CCc1nc(C2CCCCCC2)no1
InChIInChI=1S/C12H18N2O3/c15-11(16)8-7-10-13-12(14-17-10)9-5-3-1-2-4-6-9/h9H,1-8H2,(H,15,16)
InChIKeyPCBAJVYQRGBYAQ-UHFFFAOYSA-N
MW238.29 g/mol
LogP2.52
Rot. Bonds4

About 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid

3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid (PubChem CID 65390508) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid
PubChem CID65390508
Molecular FormulaC12H18N2O3
Molecular Weight238.29 g/mol
Exact Mass238.13
IUPAC Name3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid
SMILESO=C(O)CCc1nc(C2CCCCCC2)no1
InChIInChI=1S/C12H18N2O3/c15-11(16)8-7-10-13-12(14-17-10)9-5-3-1-2-4-6-9/h9H,1-8H2,(H,15,16)
InChIKeyPCBAJVYQRGBYAQ-UHFFFAOYSA-N
XLogP2.52
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.29
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid?
The IUPAC name of 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid (CID 65390508) is 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid.
What is the SMILES notation for 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid?
The canonical SMILES for 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid is O=C(O)CCc1nc(C2CCCCCC2)no1.
What is the InChIKey of 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid?
The InChIKey is PCBAJVYQRGBYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c15-11(16)8-7-10-13-12(14-17-10)9-5-3-1-2-4-6-9/h9H,1-8H2,(H,15,16).
What are the key properties of 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid?
3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid has a molecular weight of 238.29 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)propanoic acid is sourced from PubChem (CID 65390508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).