C11H18N2O2 — CID 80611110
(3-cyclooctyl-1,2,4-oxadiazol-5-yl)methanol (PubChem CID 80611110) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (3-cyclooctyl-1,2,4-oxadiazol-5-yl)methanol.
| Compound Name | (3-cyclooctyl-1,2,4-oxadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 80611110 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3-cyclooctyl-1,2,4-oxadiazol-5-yl)methanol |
| SMILES | OCc1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C11H18N2O2/c14-8-10-12-11(13-15-10)9-6-4-2-1-3-5-7-9/h9,14H,1-8H2 |
| InChIKey | SSHVWBOJWMCLCR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |