C13H23N3O — CID 29032656
5-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)pentan-1-amine (PubChem CID 29032656) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 5-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)pentan-1-amine.
| Compound Name | 5-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 29032656 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 5-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
| SMILES | NCCCCCc1nc(C2CCCCC2)no1 |
| InChI | InChI=1S/C13H23N3O/c14-10-6-2-5-9-12-15-13(16-17-12)11-7-3-1-4-8-11/h11H,1-10,14H2 |
| InChIKey | OUYBQOUPFHBGQG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|