C12H21N3O2 — CID 65330439
6-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]hexan-1-amine (PubChem CID 65330439) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]hexan-1-amine.
| Compound Name | 6-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]hexan-1-amine |
|---|---|
| PubChem CID | 65330439 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 6-[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]hexan-1-amine |
| SMILES | NCCCCCCc1nc(C2CCOC2)no1 |
| InChI | InChI=1S/C12H21N3O2/c13-7-4-2-1-3-5-11-14-12(15-17-11)10-6-8-16-9-10/h10H,1-9,13H2 |
| InChIKey | MEJZGWOAGVKIGK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|