C9H10F3N3O — CID 106525870
4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]butanenitrile (PubChem CID 106525870) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]butanenitrile.
| Compound Name | 4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]butanenitrile |
|---|---|
| PubChem CID | 106525870 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]butanenitrile |
| SMILES | N#CCCCc1nc(CCC(F)(F)F)no1 |
| InChI | InChI=1S/C9H10F3N3O/c10-9(11,12)5-4-7-14-8(16-15-7)3-1-2-6-13/h1-5H2 |
| InChIKey | AVNHXERGDZPTQQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|