C13H14ClF2N3O2 — CID 103146434
4-chloro-N-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 103146434) has the molecular formula C13H14ClF2N3O2 and a molecular weight of 317.72 g/mol. Its IUPAC name is 4-chloro-N-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | 4-chloro-N-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 103146434 |
| Molecular Formula | C13H14ClF2N3O2 |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-chloro-N-[[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | FC(F)COCCc1noc(CNc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H14ClF2N3O2/c14-9-1-3-10(4-2-9)17-7-13-18-12(19-21-13)5-6-20-8-11(15)16/h1-4,11,17H,5-8H2 |
| InChIKey | XUQBTYSZEWAECG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|