C13H25N3O2 — CID 104633234
2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol (PubChem CID 104633234) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol.
| Compound Name | 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 104633234 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol |
| SMILES | CCCCCCCCCc1nc(C(N)CO)no1 |
| InChI | InChI=1S/C13H25N3O2/c1-2-3-4-5-6-7-8-9-12-15-13(16-18-12)11(14)10-17/h11,17H,2-10,14H2,1H3 |
| InChIKey | GBEFMVXVVLGTOL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|