About 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol
2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol (PubChem CID 104633234) has the molecular formula C13H25N3O2
and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol |
| PubChem CID | 104633234 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol |
| SMILES | CCCCCCCCCc1nc(C(N)CO)no1 |
| InChI | InChI=1S/C13H25N3O2/c1-2-3-4-5-6-7-8-9-12-15-13(16-18-12)11(14)10-17/h11,17H,2-10,14H2,1H3 |
| InChIKey | GBEFMVXVVLGTOL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol?
The IUPAC name of 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol (CID 104633234) is 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol.
What is the SMILES notation for 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol?
The canonical SMILES for 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol is CCCCCCCCCc1nc(C(N)CO)no1.
What is the InChIKey of 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol?
The InChIKey is GBEFMVXVVLGTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O2/c1-2-3-4-5-6-7-8-9-12-15-13(16-18-12)11(14)10-17/h11,17H,2-10,14H2,1H3.
What are the key properties of 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol?
2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol has a molecular weight of 255.36 g/mol, XLogP of 2.35, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(5-nonyl-1,2,4-oxadiazol-3-yl)ethanol is sourced from PubChem (CID 104633234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).