C16H31N3O — CID 65428333
3-(5-undecyl-1,2,4-oxadiazol-3-yl)propan-1-amine (PubChem CID 65428333) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-(5-undecyl-1,2,4-oxadiazol-3-yl)propan-1-amine.
| Compound Name | 3-(5-undecyl-1,2,4-oxadiazol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 65428333 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 3-(5-undecyl-1,2,4-oxadiazol-3-yl)propan-1-amine |
| SMILES | CCCCCCCCCCCc1nc(CCCN)no1 |
| InChI | InChI=1S/C16H31N3O/c1-2-3-4-5-6-7-8-9-10-13-16-18-15(19-20-16)12-11-14-17/h2-14,17H2,1H3 |
| InChIKey | WHTGYBSQPFTQRO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|