C13H25N3O — CID 10900725
3-undecyl-1,2,4-oxadiazol-5-amine (PubChem CID 10900725) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-undecyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-undecyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 10900725 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 3-undecyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCCCCCCCCCCc1noc(N)n1 |
| InChI | InChI=1S/C13H25N3O/c1-2-3-4-5-6-7-8-9-10-11-12-15-13(14)17-16-12/h2-11H2,1H3,(H2,14,15,16) |
| InChIKey | KWPJACTVJSJHOB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|