C7H13N3O — CID 139520354
3-pentyl-1,2,4-oxadiazol-5-amine (PubChem CID 139520354) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-pentyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-pentyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 139520354 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3-pentyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCCCCc1noc(N)n1 |
| InChI | InChI=1S/C7H13N3O/c1-2-3-4-5-6-9-7(8)11-10-6/h2-5H2,1H3,(H2,8,9,10) |
| InChIKey | YJOBHEFCDXBSQN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|