C7H9N5O — CID 131052628
3-(2-pyrazol-1-ylethyl)-1,2,4-oxadiazol-5-amine (PubChem CID 131052628) has the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. Its IUPAC name is 3-(2-pyrazol-1-ylethyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(2-pyrazol-1-ylethyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 131052628 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 3-(2-pyrazol-1-ylethyl)-1,2,4-oxadiazol-5-amine |
| SMILES | Nc1nc(CCn2cccn2)no1 |
| InChI | InChI=1S/C7H9N5O/c8-7-10-6(11-13-7)2-5-12-4-1-3-9-12/h1,3-4H,2,5H2,(H2,8,10,11) |
| InChIKey | BARRVIYKBBTEIM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |