C10H16N6 — CID 79541998
5-propyl-1-(2-pyrazol-1-ylethyl)triazol-4-amine (PubChem CID 79541998) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 5-propyl-1-(2-pyrazol-1-ylethyl)triazol-4-amine.
| Compound Name | 5-propyl-1-(2-pyrazol-1-ylethyl)triazol-4-amine |
|---|---|
| PubChem CID | 79541998 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-propyl-1-(2-pyrazol-1-ylethyl)triazol-4-amine |
| SMILES | CCCc1c(N)nnn1CCn1cccn1 |
| InChI | InChI=1S/C10H16N6/c1-2-4-9-10(11)13-14-16(9)8-7-15-6-3-5-12-15/h3,5-6H,2,4,7-8,11H2,1H3 |
| InChIKey | FRIHBOMTXKMRBG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |