C11H13FN4 — CID 61459841
5-fluoro-3-N-(2-pyrazol-1-ylethyl)benzene-1,3-diamine (PubChem CID 61459841) has the molecular formula C11H13FN4 and a molecular weight of 220.25 g/mol. Its IUPAC name is 5-fluoro-3-N-(2-pyrazol-1-ylethyl)benzene-1,3-diamine.
| Compound Name | 5-fluoro-3-N-(2-pyrazol-1-ylethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 61459841 |
| Molecular Formula | C11H13FN4 |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 5-fluoro-3-N-(2-pyrazol-1-ylethyl)benzene-1,3-diamine |
| SMILES | Nc1cc(F)cc(NCCn2cccn2)c1 |
| InChI | InChI=1S/C11H13FN4/c12-9-6-10(13)8-11(7-9)14-3-5-16-4-1-2-15-16/h1-2,4,6-8,14H,3,5,13H2 |
| InChIKey | MGWYMPOMPVATNK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|