C11H10F3N3 — CID 54961881
2,3,4-trifluoro-N-(2-pyrazol-1-ylethyl)aniline (PubChem CID 54961881) has the molecular formula C11H10F3N3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(2-pyrazol-1-ylethyl)aniline.
| Compound Name | 2,3,4-trifluoro-N-(2-pyrazol-1-ylethyl)aniline |
|---|---|
| PubChem CID | 54961881 |
| Molecular Formula | C11H10F3N3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2,3,4-trifluoro-N-(2-pyrazol-1-ylethyl)aniline |
| SMILES | Fc1ccc(NCCn2cccn2)c(F)c1F |
| InChI | InChI=1S/C11H10F3N3/c12-8-2-3-9(11(14)10(8)13)15-5-7-17-6-1-4-16-17/h1-4,6,15H,5,7H2 |
| InChIKey | VYMRWBXOTUWEQX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|