C12H12F2N4S — CID 107934666
2,3-difluoro-4-(2-pyrazol-1-ylethylamino)benzenecarbothioamide (PubChem CID 107934666) has the molecular formula C12H12F2N4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-pyrazol-1-ylethylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(2-pyrazol-1-ylethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107934666 |
| Molecular Formula | C12H12F2N4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2,3-difluoro-4-(2-pyrazol-1-ylethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCn2cccn2)c(F)c1F |
| InChI | InChI=1S/C12H12F2N4S/c13-10-8(12(15)19)2-3-9(11(10)14)16-5-7-18-6-1-4-17-18/h1-4,6,16H,5,7H2,(H2,15,19) |
| InChIKey | WYHXAAIUJOBBNX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|