C9H9F2N3OS — CID 107934350
2-(4-carbamothioyl-2,3-difluoroanilino)acetamide (PubChem CID 107934350) has the molecular formula C9H9F2N3OS and a molecular weight of 245.25 g/mol. Its IUPAC name is 2-(4-carbamothioyl-2,3-difluoroanilino)acetamide.
| Compound Name | 2-(4-carbamothioyl-2,3-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 107934350 |
| Molecular Formula | C9H9F2N3OS |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(4-carbamothioyl-2,3-difluoroanilino)acetamide |
| SMILES | NC(=O)CNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C9H9F2N3OS/c10-7-4(9(13)16)1-2-5(8(7)11)14-3-6(12)15/h1-2,14H,3H2,(H2,12,15)(H2,13,16) |
| InChIKey | UCDMFGIWBGYLIF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|