4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid

C10H10F2N2O3 — CID 79837698

IUPAC4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid
SMILESNC(=O)CCNc1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C10H10F2N2O3/c11-8-5(10(16)17)1-2-6(9(8)12)14-4-3-7(13)15/h1-2,14H,3-4H2,(H2,13,15)(H,16,17)
InChIKeyVRGFALKZFGQAKS-UHFFFAOYSA-N
MW244.20 g/mol
LogP0.95
Rot. Bonds5

About 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid

4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid (PubChem CID 79837698) has the molecular formula C10H10F2N2O3 and a molecular weight of 244.20 g/mol. Its IUPAC name is 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid.

Molecular Properties

Compound Name4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid
PubChem CID79837698
Molecular FormulaC10H10F2N2O3
Molecular Weight244.20 g/mol
Exact Mass244.07
IUPAC Name4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid
SMILESNC(=O)CCNc1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C10H10F2N2O3/c11-8-5(10(16)17)1-2-6(9(8)12)14-4-3-7(13)15/h1-2,14H,3-4H2,(H2,13,15)(H,16,17)
InChIKeyVRGFALKZFGQAKS-UHFFFAOYSA-N
XLogP0.95
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.20
LogP ≤ 50.95
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid?
The IUPAC name of 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid (CID 79837698) is 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid.
What is the SMILES notation for 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid?
The canonical SMILES for 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid is NC(=O)CCNc1ccc(C(=O)O)c(F)c1F.
What is the InChIKey of 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid?
The InChIKey is VRGFALKZFGQAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N2O3/c11-8-5(10(16)17)1-2-6(9(8)12)14-4-3-7(13)15/h1-2,14H,3-4H2,(H2,13,15)(H,16,17).
What are the key properties of 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid?
4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid has a molecular weight of 244.20 g/mol, XLogP of 0.95, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-amino-3-oxopropyl)amino]-2,3-difluorobenzoic acid is sourced from PubChem (CID 79837698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).