C10H8F5NO2S — CID 106431100
2,3-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid (PubChem CID 106431100) has the molecular formula C10H8F5NO2S and a molecular weight of 301.24 g/mol. Its IUPAC name is 2,3-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid.
| Compound Name | 2,3-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106431100 |
| Molecular Formula | C10H8F5NO2S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2,3-difluoro-4-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCCSC(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10H8F5NO2S/c11-7-5(9(17)18)1-2-6(8(7)12)16-3-4-19-10(13,14)15/h1-2,16H,3-4H2,(H,17,18) |
| InChIKey | CEOVNXQYEXPARN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|