C14H19F2NO2 — CID 83144082
2,3-difluoro-4-(2,3,3-trimethylbutylamino)benzoic acid (PubChem CID 83144082) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2,3-difluoro-4-(2,3,3-trimethylbutylamino)benzoic acid.
| Compound Name | 2,3-difluoro-4-(2,3,3-trimethylbutylamino)benzoic acid |
|---|---|
| PubChem CID | 83144082 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2,3-difluoro-4-(2,3,3-trimethylbutylamino)benzoic acid |
| SMILES | CC(CNc1ccc(C(=O)O)c(F)c1F)C(C)(C)C |
| InChI | InChI=1S/C14H19F2NO2/c1-8(14(2,3)4)7-17-10-6-5-9(13(18)19)11(15)12(10)16/h5-6,8,17H,7H2,1-4H3,(H,18,19) |
| InChIKey | YZODGGAUJFHWOV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |