C11H13F2NO3 — CID 83187633
2,3-difluoro-4-(4-hydroxybutan-2-ylamino)benzoic acid (PubChem CID 83187633) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is 2,3-difluoro-4-(4-hydroxybutan-2-ylamino)benzoic acid.
| Compound Name | 2,3-difluoro-4-(4-hydroxybutan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 83187633 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2,3-difluoro-4-(4-hydroxybutan-2-ylamino)benzoic acid |
| SMILES | CC(CCO)Nc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C11H13F2NO3/c1-6(4-5-15)14-8-3-2-7(11(16)17)9(12)10(8)13/h2-3,6,14-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | WQJCQURZEGJBGO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |