C12H15F2NO2S — CID 113499160
4-(1-ethylsulfanylpropan-2-ylamino)-2,3-difluorobenzoic acid (PubChem CID 113499160) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is 4-(1-ethylsulfanylpropan-2-ylamino)-2,3-difluorobenzoic acid.
| Compound Name | 4-(1-ethylsulfanylpropan-2-ylamino)-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 113499160 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 4-(1-ethylsulfanylpropan-2-ylamino)-2,3-difluorobenzoic acid |
| SMILES | CCSCC(C)Nc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C12H15F2NO2S/c1-3-18-6-7(2)15-9-5-4-8(12(16)17)10(13)11(9)14/h4-5,7,15H,3,6H2,1-2H3,(H,16,17) |
| InChIKey | GOQQQJXUSYXAIE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |