C13H13F2NO2 — CID 113477703
2,3-difluoro-4-(hex-5-yn-3-ylamino)benzoic acid (PubChem CID 113477703) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 2,3-difluoro-4-(hex-5-yn-3-ylamino)benzoic acid.
| Compound Name | 2,3-difluoro-4-(hex-5-yn-3-ylamino)benzoic acid |
|---|---|
| PubChem CID | 113477703 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2,3-difluoro-4-(hex-5-yn-3-ylamino)benzoic acid |
| SMILES | C#CCC(CC)Nc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C13H13F2NO2/c1-3-5-8(4-2)16-10-7-6-9(13(17)18)11(14)12(10)15/h1,6-8,16H,4-5H2,2H3,(H,17,18) |
| InChIKey | VZDXXIXAYHURMX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|