C14H15F2NO2 — CID 79837425
4-(dicyclopropylmethylamino)-2,3-difluorobenzoic acid (PubChem CID 79837425) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is 4-(dicyclopropylmethylamino)-2,3-difluorobenzoic acid.
| Compound Name | 4-(dicyclopropylmethylamino)-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 79837425 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-(dicyclopropylmethylamino)-2,3-difluorobenzoic acid |
| SMILES | O=C(O)c1ccc(NC(C2CC2)C2CC2)c(F)c1F |
| InChI | InChI=1S/C14H15F2NO2/c15-11-9(14(18)19)5-6-10(12(11)16)17-13(7-1-2-7)8-3-4-8/h5-8,13,17H,1-4H2,(H,18,19) |
| InChIKey | FKRBYXFDRBCHFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |