C12H13F2NO4 — CID 79837706
4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2,3-difluorobenzoic acid (PubChem CID 79837706) has the molecular formula C12H13F2NO4 and a molecular weight of 273.24 g/mol. Its IUPAC name is 4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2,3-difluorobenzoic acid.
| Compound Name | 4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 79837706 |
| Molecular Formula | C12H13F2NO4 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2,3-difluorobenzoic acid |
| SMILES | CCOC(=O)C(C)Nc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C12H13F2NO4/c1-3-19-12(18)6(2)15-8-5-4-7(11(16)17)9(13)10(8)14/h4-6,15H,3H2,1-2H3,(H,16,17) |
| InChIKey | MWCKPHDZHIBGBR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |