C12H14F2N2O2S — CID 107934699
ethyl 2-(4-carbamothioyl-2,3-difluoroanilino)propanoate (PubChem CID 107934699) has the molecular formula C12H14F2N2O2S and a molecular weight of 288.32 g/mol. Its IUPAC name is ethyl 2-(4-carbamothioyl-2,3-difluoroanilino)propanoate.
| Compound Name | ethyl 2-(4-carbamothioyl-2,3-difluoroanilino)propanoate |
|---|---|
| PubChem CID | 107934699 |
| Molecular Formula | C12H14F2N2O2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | ethyl 2-(4-carbamothioyl-2,3-difluoroanilino)propanoate |
| SMILES | CCOC(=O)C(C)Nc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C12H14F2N2O2S/c1-3-18-12(17)6(2)16-8-5-4-7(11(15)19)9(13)10(8)14/h4-6,16H,3H2,1-2H3,(H2,15,19) |
| InChIKey | OPHCAVDZCUATBR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|