C13H17F2N3OS — CID 107934848
3-(4-carbamothioyl-2,3-difluoroanilino)-N-propylpropanamide (PubChem CID 107934848) has the molecular formula C13H17F2N3OS and a molecular weight of 301.36 g/mol. Its IUPAC name is 3-(4-carbamothioyl-2,3-difluoroanilino)-N-propylpropanamide.
| Compound Name | 3-(4-carbamothioyl-2,3-difluoroanilino)-N-propylpropanamide |
|---|---|
| PubChem CID | 107934848 |
| Molecular Formula | C13H17F2N3OS |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-(4-carbamothioyl-2,3-difluoroanilino)-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C13H17F2N3OS/c1-2-6-18-10(19)5-7-17-9-4-3-8(13(16)20)11(14)12(9)15/h3-4,17H,2,5-7H2,1H3,(H2,16,20)(H,18,19) |
| InChIKey | CBJUFNSGAVWNSX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|