C13H17F2N3OS — CID 107935158
N-tert-butyl-2-(4-carbamothioyl-2,3-difluoroanilino)acetamide (PubChem CID 107935158) has the molecular formula C13H17F2N3OS and a molecular weight of 301.36 g/mol. Its IUPAC name is N-tert-butyl-2-(4-carbamothioyl-2,3-difluoroanilino)acetamide.
| Compound Name | N-tert-butyl-2-(4-carbamothioyl-2,3-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 107935158 |
| Molecular Formula | C13H17F2N3OS |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-tert-butyl-2-(4-carbamothioyl-2,3-difluoroanilino)acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C13H17F2N3OS/c1-13(2,3)18-9(19)6-17-8-5-4-7(12(16)20)10(14)11(8)15/h4-5,17H,6H2,1-3H3,(H2,16,20)(H,18,19) |
| InChIKey | ABXQBTXMLDVZRZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|