C10H13F2N3O2S2 — CID 107934552
2,3-difluoro-4-[2-(methanesulfonamido)ethylamino]benzenecarbothioamide (PubChem CID 107934552) has the molecular formula C10H13F2N3O2S2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2,3-difluoro-4-[2-(methanesulfonamido)ethylamino]benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-[2-(methanesulfonamido)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107934552 |
| Molecular Formula | C10H13F2N3O2S2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2,3-difluoro-4-[2-(methanesulfonamido)ethylamino]benzenecarbothioamide |
| SMILES | CS(=O)(=O)NCCNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C10H13F2N3O2S2/c1-19(16,17)15-5-4-14-7-3-2-6(10(13)18)8(11)9(7)12/h2-3,14-15H,4-5H2,1H3,(H2,13,18) |
| InChIKey | OKNZYHUHXXBVQE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|