C11H14F3N3O2S2 — CID 43546238
2-[2-(methanesulfonamido)ethylamino]-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 43546238) has the molecular formula C11H14F3N3O2S2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethylamino]-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-[2-(methanesulfonamido)ethylamino]-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43546238 |
| Molecular Formula | C11H14F3N3O2S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[2-(methanesulfonamido)ethylamino]-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CS(=O)(=O)NCCNc1ccc(C(F)(F)F)cc1C(N)=S |
| InChI | InChI=1S/C11H14F3N3O2S2/c1-21(18,19)17-5-4-16-9-3-2-7(11(12,13)14)6-8(9)10(15)20/h2-3,6,16-17H,4-5H2,1H3,(H2,15,20) |
| InChIKey | HLPYHKDKSSJASN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|