C11H9F7N2S — CID 106292938
2-(2,2,3,3-tetrafluoropropylamino)-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 106292938) has the molecular formula C11H9F7N2S and a molecular weight of 334.26 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropylamino)-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-(2,2,3,3-tetrafluoropropylamino)-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 106292938 |
| Molecular Formula | C11H9F7N2S |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropylamino)-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(C(F)(F)F)ccc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H9F7N2S/c12-9(13)10(14,15)4-20-7-2-1-5(11(16,17)18)3-6(7)8(19)21/h1-3,9,20H,4H2,(H2,19,21) |
| InChIKey | IKQSKEYNKRXKIK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|