C12H13F3N2OS — CID 112556231
N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-methylpropanamide (PubChem CID 112556231) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-methylpropanamide.
| Compound Name | N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 112556231 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(F)(F)F)cc1C(N)=S |
| InChI | InChI=1S/C12H13F3N2OS/c1-6(2)11(18)17-9-4-3-7(12(13,14)15)5-8(9)10(16)19/h3-6H,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | LMXUNAXPXIFMGX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|