C13H15F3N2O2S — CID 107939065
N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-propoxyacetamide (PubChem CID 107939065) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-propoxyacetamide.
| Compound Name | N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-propoxyacetamide |
|---|---|
| PubChem CID | 107939065 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-[2-carbamothioyl-4-(trifluoromethyl)phenyl]-2-propoxyacetamide |
| SMILES | CCCOCC(=O)Nc1ccc(C(F)(F)F)cc1C(N)=S |
| InChI | InChI=1S/C13H15F3N2O2S/c1-2-5-20-7-11(19)18-10-4-3-8(13(14,15)16)6-9(10)12(17)21/h3-4,6H,2,5,7H2,1H3,(H2,17,21)(H,18,19) |
| InChIKey | LKBSJSDHRBRUBP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|