C9H9F3N2O — CID 71246779
2-(methylamino)-5-(trifluoromethyl)benzamide (PubChem CID 71246779) has the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. Its IUPAC name is 2-(methylamino)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(methylamino)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71246779 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-(methylamino)-5-(trifluoromethyl)benzamide |
| SMILES | CNc1ccc(C(F)(F)F)cc1C(N)=O |
| InChI | InChI=1S/C9H9F3N2O/c1-14-7-3-2-5(9(10,11)12)4-6(7)8(13)15/h2-4,14H,1H3,(H2,13,15) |
| InChIKey | VIMFPIGBAYDUJG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |