C12H13F3N2O2 — CID 140559986
2-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-5-(trifluoromethyl)benzamide (PubChem CID 140559986) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140559986 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-5-(trifluoromethyl)benzamide |
| SMILES | CNC(=O)[C@@H](C)c1ccc(C(F)(F)F)cc1C(N)=O |
| InChI | InChI=1S/C12H13F3N2O2/c1-6(11(19)17-2)8-4-3-7(12(13,14)15)5-9(8)10(16)18/h3-6H,1-2H3,(H2,16,18)(H,17,19)/t6-/m0/s1 |
| InChIKey | AXDGNBPYMGLFMT-LURJTMIESA-N |
| XLogP | 1.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |